C19H12F5N3O2 — CID 56682591
N'-[(2-fluorophenyl)methyl]-N-hydroxy-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide (PubChem CID 56682591) has the molecular formula C19H12F5N3O2 and a molecular weight of 409.31 g/mol. Its IUPAC name is N'-[(2-fluorophenyl)methyl]-N-hydroxy-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide.
| Compound Name | N'-[(2-fluorophenyl)methyl]-N-hydroxy-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56682591 |
| Molecular Formula | C19H12F5N3O2 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N'-[(2-fluorophenyl)methyl]-N-hydroxy-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide |
| SMILES | ON/C(=N\Cc1ccccc1F)c1ccc(Oc2c(F)c(F)cc(F)c2F)nc1 |
| InChI | InChI=1S/C19H12F5N3O2/c20-12-4-2-1-3-10(12)8-26-19(27-28)11-5-6-15(25-9-11)29-18-16(23)13(21)7-14(22)17(18)24/h1-7,9,28H,8H2,(H,26,27) |
| InChIKey | IGPSLUSRTQUHHQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|