C24H23N5O2 — CID 56675746
N'-[(3,5-dimethylphenyl)methyl]-N-hydroxy-6-(4-imidazol-1-ylphenoxy)pyridine-3-carboximidamide (PubChem CID 56675746) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N'-[(3,5-dimethylphenyl)methyl]-N-hydroxy-6-(4-imidazol-1-ylphenoxy)pyridine-3-carboximidamide.
| Compound Name | N'-[(3,5-dimethylphenyl)methyl]-N-hydroxy-6-(4-imidazol-1-ylphenoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56675746 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N'-[(3,5-dimethylphenyl)methyl]-N-hydroxy-6-(4-imidazol-1-ylphenoxy)pyridine-3-carboximidamide |
| SMILES | Cc1cc(C)cc(C/N=C(\NO)c2ccc(Oc3ccc(-n4ccnc4)cc3)nc2)c1 |
| InChI | InChI=1S/C24H23N5O2/c1-17-11-18(2)13-19(12-17)14-27-24(28-30)20-3-8-23(26-15-20)31-22-6-4-21(5-7-22)29-10-9-25-16-29/h3-13,15-16,30H,14H2,1-2H3,(H,27,28) |
| InChIKey | COOLNIUJEGGJML-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|