C23H28O2S — CID 56682549
(8R,9S,13S,14S,17S)-13-methyl-17-(4-methylthiophen-2-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 56682549) has the molecular formula C23H28O2S and a molecular weight of 368.54 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-13-methyl-17-(4-methylthiophen-2-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-13-methyl-17-(4-methylthiophen-2-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 56682549 |
| Molecular Formula | C23H28O2S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (8R,9S,13S,14S,17S)-13-methyl-17-(4-methylthiophen-2-yl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | Cc1csc([C@]2(O)CC[C@H]3[C@@H]4CCc5cc(O)ccc5[C@H]4CC[C@@]32C)c1 |
| InChI | InChI=1S/C23H28O2S/c1-14-11-21(26-13-14)23(25)10-8-20-19-5-3-15-12-16(24)4-6-17(15)18(19)7-9-22(20,23)2/h4,6,11-13,18-20,24-25H,3,5,7-10H2,1-2H3/t18-,19-,20+,22+,23-/m1/s1 |
| InChIKey | YIILLTHQHVJGCZ-BQLVWXCYSA-N |
| XLogP | 5.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |