C31H36O4 — CID 67159250
1-[2-acetyl-5-[(8R,9S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1,3-dihydroinden-2-yl]ethanone (PubChem CID 67159250) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is 1-[2-acetyl-5-[(8R,9S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1,3-dihydroinden-2-yl]ethanone.
| Compound Name | 1-[2-acetyl-5-[(8R,9S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1,3-dihydroinden-2-yl]ethanone |
|---|---|
| PubChem CID | 67159250 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 1-[2-acetyl-5-[(8R,9S,13S,14S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-1,3-dihydroinden-2-yl]ethanone |
| SMILES | CC(=O)C1(C(C)=O)Cc2ccc([C@@]3(O)CC[C@H]4[C@@H]5CCc6cc(O)ccc6[C@H]5CC[C@@]43C)cc2C1 |
| InChI | InChI=1S/C31H36O4/c1-18(32)30(19(2)33)16-21-4-6-23(14-22(21)17-30)31(35)13-11-28-27-8-5-20-15-24(34)7-9-25(20)26(27)10-12-29(28,31)3/h4,6-7,9,14-15,26-28,34-35H,5,8,10-13,16-17H2,1-3H3/t26-,27-,28+,29+,31+/m1/s1 |
| InChIKey | DLSWVRDRLFHXKU-MZPPDMDNSA-N |
| XLogP | 5.40 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|