C33H37NO4S — CID 67159486
(8R,9S,13S,14S,17R)-13-methyl-17-[2-(4-methylphenyl)sulfonyl-2,3-dihydro-1H-indol-5-yl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 67159486) has the molecular formula C33H37NO4S and a molecular weight of 543.73 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-13-methyl-17-[2-(4-methylphenyl)sulfonyl-2,3-dihydro-1H-indol-5-yl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17R)-13-methyl-17-[2-(4-methylphenyl)sulfonyl-2,3-dihydro-1H-indol-5-yl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 67159486 |
| Molecular Formula | C33H37NO4S |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | (8R,9S,13S,14S,17R)-13-methyl-17-[2-(4-methylphenyl)sulfonyl-2,3-dihydro-1H-indol-5-yl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | Cc1ccc(S(=O)(=O)C2Cc3cc([C@@]4(O)CC[C@H]5[C@@H]6CCc7cc(O)ccc7[C@H]6CC[C@@]54C)ccc3N2)cc1 |
| InChI | InChI=1S/C33H37NO4S/c1-20-3-8-25(9-4-20)39(37,38)31-19-22-17-23(6-12-30(22)34-31)33(36)16-14-29-28-10-5-21-18-24(35)7-11-26(21)27(28)13-15-32(29,33)2/h3-4,6-9,11-12,17-18,27-29,31,34-36H,5,10,13-16,19H2,1-2H3/t27-,28-,29+,31?,32+,33+/m1/s1 |
| InChIKey | IUVGBVPPPMVYFJ-AIKYVRAJSA-N |
| XLogP | 6.21 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |