C24H24N4O2 — CID 56683316
4-(4-methoxyphenyl)-1'-methylspiro[5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaene-14,3'-azetidine]-12-one (PubChem CID 56683316) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1'-methylspiro[5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaene-14,3'-azetidine]-12-one.
| Compound Name | 4-(4-methoxyphenyl)-1'-methylspiro[5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaene-14,3'-azetidine]-12-one |
|---|---|
| PubChem CID | 56683316 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-(4-methoxyphenyl)-1'-methylspiro[5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaene-14,3'-azetidine]-12-one |
| SMILES | COc1ccc(-c2cc3c(cn2)CCc2c-3[nH]c3c2C(=O)NC2(C3)CN(C)C2)cc1 |
| InChI | InChI=1S/C24H24N4O2/c1-28-12-24(13-28)10-20-21(23(29)27-24)17-8-5-15-11-25-19(9-18(15)22(17)26-20)14-3-6-16(30-2)7-4-14/h3-4,6-7,9,11,26H,5,8,10,12-13H2,1-2H3,(H,27,29) |
| InChIKey | PCOZFCUKHHNFQO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |