C22H21N5O — CID 59558361
17-methyl-4-pyridin-4-ylspiro[5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaene-14,3'-azetidine]-12-one (PubChem CID 59558361) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 17-methyl-4-pyridin-4-ylspiro[5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaene-14,3'-azetidine]-12-one.
| Compound Name | 17-methyl-4-pyridin-4-ylspiro[5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaene-14,3'-azetidine]-12-one |
|---|---|
| PubChem CID | 59558361 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 17-methyl-4-pyridin-4-ylspiro[5,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaene-14,3'-azetidine]-12-one |
| SMILES | Cn1c2c(c3c1-c1cc(-c4ccncc4)ncc1CC3)C(=O)NC1(CNC1)C2 |
| InChI | InChI=1S/C22H21N5O/c1-27-18-9-22(11-24-12-22)26-21(28)19(18)15-3-2-14-10-25-17(8-16(14)20(15)27)13-4-6-23-7-5-13/h4-8,10,24H,2-3,9,11-12H2,1H3,(H,26,28) |
| InChIKey | QTSBLWZTJSXLEP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |