C20H19BrN4O5 — CID 56684725
N-[(2-bromophenyl)methyl]-N-methyl-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 56684725) has the molecular formula C20H19BrN4O5 and a molecular weight of 475.30 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N-methyl-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(2-bromophenyl)methyl]-N-methyl-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 56684725 |
| Molecular Formula | C20H19BrN4O5 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N-methyl-2-[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CN1C(=O)NC(C)(c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C20H19BrN4O5/c1-20(14-7-5-8-15(10-14)25(29)30)18(27)24(19(28)22-20)12-17(26)23(2)11-13-6-3-4-9-16(13)21/h3-10H,11-12H2,1-2H3,(H,22,28) |
| InChIKey | ODQCSYAWUQFISR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|