C26H26N6O — CID 56685132
3-[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]-N-(2-phenylethyl)propanamide (PubChem CID 56685132) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is 3-[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]-N-(2-phenylethyl)propanamide.
| Compound Name | 3-[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 56685132 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 3-[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,10-pentaen-5-yl]-N-(2-phenylethyl)propanamide |
| SMILES | Cc1ccc(C)c(-c2cc3c4nnc(CCC(=O)NCCc5ccccc5)n4ccn3n2)c1 |
| InChI | InChI=1S/C26H26N6O/c1-18-8-9-19(2)21(16-18)22-17-23-26-29-28-24(31(26)14-15-32(23)30-22)10-11-25(33)27-13-12-20-6-4-3-5-7-20/h3-9,14-17H,10-13H2,1-2H3,(H,27,33) |
| InChIKey | UYCXZJQGBOBTFG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |