C24H21FN4O3 — CID 56685548
2-[4-[(4-fluorophenyl)methylamino]-2-oxoquinazolin-1-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 56685548) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methylamino]-2-oxoquinazolin-1-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[4-[(4-fluorophenyl)methylamino]-2-oxoquinazolin-1-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 56685548 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methylamino]-2-oxoquinazolin-1-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c(=O)nc(NCc3ccc(F)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H21FN4O3/c1-32-19-12-10-18(11-13-19)27-22(30)15-29-21-5-3-2-4-20(21)23(28-24(29)31)26-14-16-6-8-17(25)9-7-16/h2-13H,14-15H2,1H3,(H,27,30)(H,26,28,31) |
| InChIKey | YRMVSYUSNZUZEL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |