C22H25FN4O2 — CID 56685587
N-(3-fluoro-4-methylphenyl)-2-[4-(3-methylbutylamino)-2-oxoquinazolin-1-yl]acetamide (PubChem CID 56685587) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-[4-(3-methylbutylamino)-2-oxoquinazolin-1-yl]acetamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-[4-(3-methylbutylamino)-2-oxoquinazolin-1-yl]acetamide |
|---|---|
| PubChem CID | 56685587 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-[4-(3-methylbutylamino)-2-oxoquinazolin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(=O)nc(NCCC(C)C)c3ccccc32)cc1F |
| InChI | InChI=1S/C22H25FN4O2/c1-14(2)10-11-24-21-17-6-4-5-7-19(17)27(22(29)26-21)13-20(28)25-16-9-8-15(3)18(23)12-16/h4-9,12,14H,10-11,13H2,1-3H3,(H,25,28)(H,24,26,29) |
| InChIKey | RWPDZJQEOKZNDM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |