About methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate
methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate (PubChem CID 56689977) has the molecular formula C13H16O4S
and a molecular weight of 268.33 g/mol. Its IUPAC name is methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate |
| PubChem CID | 56689977 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(S(=O)(=O)c2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C13H16O4S/c1-9-4-5-11(8-10(9)2)18(15,16)13(6-7-13)12(14)17-3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | CCPGODMJTVYRHV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate?
The IUPAC name of methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate (CID 56689977) is methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate is COC(=O)C1(S(=O)(=O)c2ccc(C)c(C)c2)CC1.
What is the InChIKey of methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate?
The InChIKey is CCPGODMJTVYRHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4S/c1-9-4-5-11(8-10(9)2)18(15,16)13(6-7-13)12(14)17-3/h4-5,8H,6-7H2,1-3H3.
What are the key properties of methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate?
methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate has a molecular weight of 268.33 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3,4-dimethylphenyl)sulfonylcyclopropane-1-carboxylate is sourced from PubChem (CID 56689977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).