C18H24N2O4S — CID 30887318
4-[1-(3,4-dimethylphenyl)sulfonylcyclopentanecarbonyl]piperazin-2-one (PubChem CID 30887318) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 4-[1-(3,4-dimethylphenyl)sulfonylcyclopentanecarbonyl]piperazin-2-one.
| Compound Name | 4-[1-(3,4-dimethylphenyl)sulfonylcyclopentanecarbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 30887318 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[1-(3,4-dimethylphenyl)sulfonylcyclopentanecarbonyl]piperazin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)C2(C(=O)N3CCNC(=O)C3)CCCC2)cc1C |
| InChI | InChI=1S/C18H24N2O4S/c1-13-5-6-15(11-14(13)2)25(23,24)18(7-3-4-8-18)17(22)20-10-9-19-16(21)12-20/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,19,21) |
| InChIKey | LLDPYFXURHEBCS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |