C12H12F6N2O — CID 56690790
N-[1,1,1,3,3,3-hexafluoro-2-(3-methylanilino)propan-2-yl]acetamide (PubChem CID 56690790) has the molecular formula C12H12F6N2O and a molecular weight of 314.23 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(3-methylanilino)propan-2-yl]acetamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(3-methylanilino)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 56690790 |
| Molecular Formula | C12H12F6N2O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(3-methylanilino)propan-2-yl]acetamide |
| SMILES | CC(=O)NC(Nc1cccc(C)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F6N2O/c1-7-4-3-5-9(6-7)20-10(11(13,14)15,12(16,17)18)19-8(2)21/h3-6,20H,1-2H3,(H,19,21) |
| InChIKey | PDBANCHUDQKFRA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|