C17H15N3O2 — CID 56692518
5-phenacyl-6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one (PubChem CID 56692518) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 5-phenacyl-6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one.
| Compound Name | 5-phenacyl-6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 56692518 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5-phenacyl-6-phenyl-4,5-dihydro-2H-1,2,4-triazin-3-one |
| SMILES | O=C1NN=C(c2ccccc2)C(CC(=O)c2ccccc2)N1 |
| InChI | InChI=1S/C17H15N3O2/c21-15(12-7-3-1-4-8-12)11-14-16(19-20-17(22)18-14)13-9-5-2-6-10-13/h1-10,14H,11H2,(H2,18,20,22) |
| InChIKey | YONSNUPYJVCJFW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |