C15H21NO5S2 — CID 56692775
3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide (PubChem CID 56692775) has the molecular formula C15H21NO5S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide.
| Compound Name | 3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 56692775 |
| Molecular Formula | C15H21NO5S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide |
| SMILES | Cc1ccc(S(=O)(=O)C2CS(=O)(=O)CC2N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H21NO5S2/c1-12-2-4-13(5-3-12)23(19,20)15-11-22(17,18)10-14(15)16-6-8-21-9-7-16/h2-5,14-15H,6-11H2,1H3 |
| InChIKey | NDJRXBUSJQQVOW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |