C11H13N3O4S2 — CID 56693017
(2,6-dinitrophenyl) N,N-diethylcarbamodithioate (PubChem CID 56693017) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is (2,6-dinitrophenyl) N,N-diethylcarbamodithioate.
| Compound Name | (2,6-dinitrophenyl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 56693017 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (2,6-dinitrophenyl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O4S2/c1-3-12(4-2)11(19)20-10-8(13(15)16)6-5-7-9(10)14(17)18/h5-7H,3-4H2,1-2H3 |
| InChIKey | JJXSARHZSWQXPA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|