C23H22Cl2O4S2 — CID 56695634
2,5-bis[(4-chlorophenyl)sulfonyl]-3a-ethyl-6a-methyl-1,4-dihydropentalene (PubChem CID 56695634) has the molecular formula C23H22Cl2O4S2 and a molecular weight of 497.47 g/mol. Its IUPAC name is 2,5-bis[(4-chlorophenyl)sulfonyl]-3a-ethyl-6a-methyl-1,4-dihydropentalene.
| Compound Name | 2,5-bis[(4-chlorophenyl)sulfonyl]-3a-ethyl-6a-methyl-1,4-dihydropentalene |
|---|---|
| PubChem CID | 56695634 |
| Molecular Formula | C23H22Cl2O4S2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 2,5-bis[(4-chlorophenyl)sulfonyl]-3a-ethyl-6a-methyl-1,4-dihydropentalene |
| SMILES | CCC12C=C(S(=O)(=O)c3ccc(Cl)cc3)CC1(C)C=C(S(=O)(=O)c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C23H22Cl2O4S2/c1-3-23-14-20(30(26,27)18-8-4-16(24)5-9-18)12-22(23,2)13-21(15-23)31(28,29)19-10-6-17(25)7-11-19/h4-12,15H,3,13-14H2,1-2H3 |
| InChIKey | AXTXIPRBTGJAPU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |