C23H20BrN3O3S — CID 56697874
4-bromo-N-[1-[(4-methoxyphenyl)carbamothioylamino]-2-oxo-2-phenylethyl]benzamide (PubChem CID 56697874) has the molecular formula C23H20BrN3O3S and a molecular weight of 498.40 g/mol. Its IUPAC name is 4-bromo-N-[1-[(4-methoxyphenyl)carbamothioylamino]-2-oxo-2-phenylethyl]benzamide.
| Compound Name | 4-bromo-N-[1-[(4-methoxyphenyl)carbamothioylamino]-2-oxo-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 56697874 |
| Molecular Formula | C23H20BrN3O3S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | 4-bromo-N-[1-[(4-methoxyphenyl)carbamothioylamino]-2-oxo-2-phenylethyl]benzamide |
| SMILES | COc1ccc(NC(=S)NC(NC(=O)c2ccc(Br)cc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20BrN3O3S/c1-30-19-13-11-18(12-14-19)25-23(31)27-21(20(28)15-5-3-2-4-6-15)26-22(29)16-7-9-17(24)10-8-16/h2-14,21H,1H3,(H,26,29)(H2,25,27,31) |
| InChIKey | VEFQNOXJQVNTAW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|