C20H33N5O2 — CID 56704431
5-[1-[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carbonyl]piperidin-4-yl]-4-ethyl-2-methyl-1,2,4-triazol-3-one (PubChem CID 56704431) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 5-[1-[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carbonyl]piperidin-4-yl]-4-ethyl-2-methyl-1,2,4-triazol-3-one.
| Compound Name | 5-[1-[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carbonyl]piperidin-4-yl]-4-ethyl-2-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 56704431 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 5-[1-[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-1-carbonyl]piperidin-4-yl]-4-ethyl-2-methyl-1,2,4-triazol-3-one |
| SMILES | CCn1c(C2CCN(C(=O)[C@@H]3CCCN4CCCC[C@H]34)CC2)nn(C)c1=O |
| InChI | InChI=1S/C20H33N5O2/c1-3-25-18(21-22(2)20(25)27)15-9-13-24(14-10-15)19(26)16-7-6-12-23-11-5-4-8-17(16)23/h15-17H,3-14H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | VHONNLGWDGJUSK-IAGOWNOFSA-N |
| XLogP | 1.57 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |