C19H29N5O3 — CID 97146846
2-ethyl-9-[(6S)-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl]-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 97146846) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-ethyl-9-[(6S)-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl]-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-ethyl-9-[(6S)-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl]-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 97146846 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2-ethyl-9-[(6S)-2-methyl-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl]-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | CCN1CC2(CCC1=O)CCN(C(=O)[C@H]1CCc3nn(C)c(=O)n3C1)CC2 |
| InChI | InChI=1S/C19H29N5O3/c1-3-22-13-19(7-6-16(22)25)8-10-23(11-9-19)17(26)14-4-5-15-20-21(2)18(27)24(15)12-14/h14H,3-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | RFQOYRSLQDTHLN-AWEZNQCLSA-N |
| XLogP | 0.40 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |