C16H27N5O2 — CID 91798335
6-(4-ethyl-3,3-dimethylpiperazine-1-carbonyl)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 91798335) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 6-(4-ethyl-3,3-dimethylpiperazine-1-carbonyl)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 6-(4-ethyl-3,3-dimethylpiperazine-1-carbonyl)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 91798335 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 6-(4-ethyl-3,3-dimethylpiperazine-1-carbonyl)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCN1CCN(C(=O)C2CCc3nn(C)c(=O)n3C2)CC1(C)C |
| InChI | InChI=1S/C16H27N5O2/c1-5-20-9-8-19(11-16(20,2)3)14(22)12-6-7-13-17-18(4)15(23)21(13)10-12/h12H,5-11H2,1-4H3 |
| InChIKey | QOYYZKQBCDHEFW-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |