C21H25N3O3 — CID 56706649
2-[[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]amino]-N-(2-methylphenyl)acetamide (PubChem CID 56706649) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]amino]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]amino]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 56706649 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]amino]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CNC1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H25N3O3/c1-15-4-2-3-5-18(15)23-21(25)13-22-16-8-10-24(11-9-16)17-6-7-19-20(12-17)27-14-26-19/h2-7,12,16,22H,8-11,13-14H2,1H3,(H,23,25) |
| InChIKey | LPEPEJDYGUXWFC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|