C16H24N4O3 — CID 56708447
3-(4,6-dimethoxypyrimidin-2-yl)-3,10-diazaspiro[5.6]dodecan-9-one (PubChem CID 56708447) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-(4,6-dimethoxypyrimidin-2-yl)-3,10-diazaspiro[5.6]dodecan-9-one.
| Compound Name | 3-(4,6-dimethoxypyrimidin-2-yl)-3,10-diazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 56708447 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 3-(4,6-dimethoxypyrimidin-2-yl)-3,10-diazaspiro[5.6]dodecan-9-one |
| SMILES | COc1cc(OC)nc(N2CCC3(CCNC(=O)CC3)CC2)n1 |
| InChI | InChI=1S/C16H24N4O3/c1-22-13-11-14(23-2)19-15(18-13)20-9-6-16(7-10-20)4-3-12(21)17-8-5-16/h11H,3-10H2,1-2H3,(H,17,21) |
| InChIKey | IHKMPTBKIMOQHH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |