C17H21ClN4O — CID 56709031
1-[6-(aminomethyl)-2-methylpyrimidin-4-yl]-4-(4-chlorophenyl)piperidin-4-ol (PubChem CID 56709031) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 1-[6-(aminomethyl)-2-methylpyrimidin-4-yl]-4-(4-chlorophenyl)piperidin-4-ol.
| Compound Name | 1-[6-(aminomethyl)-2-methylpyrimidin-4-yl]-4-(4-chlorophenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 56709031 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[6-(aminomethyl)-2-methylpyrimidin-4-yl]-4-(4-chlorophenyl)piperidin-4-ol |
| SMILES | Cc1nc(CN)cc(N2CCC(O)(c3ccc(Cl)cc3)CC2)n1 |
| InChI | InChI=1S/C17H21ClN4O/c1-12-20-15(11-19)10-16(21-12)22-8-6-17(23,7-9-22)13-2-4-14(18)5-3-13/h2-5,10,23H,6-9,11,19H2,1H3 |
| InChIKey | SFOUGKVSAYGYBY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |