C18H22FN3O — CID 72879432
4-(4-Fluorophenyl)-1-(2,5,6-trimethylpyrimidin-4-YL)piperidin-4-OL (PubChem CID 72879432) has the molecular formula C18H22FN3O and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-ol.
| Compound Name | 4-(4-Fluorophenyl)-1-(2,5,6-trimethylpyrimidin-4-YL)piperidin-4-OL |
|---|---|
| PubChem CID | 72879432 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-(4-fluorophenyl)-1-(2,5,6-trimethylpyrimidin-4-yl)piperidin-4-ol |
| SMILES | CC1=C(N=C(N=C1N2CCC(CC2)(C3=CC=C(C=C3)F)O)C)C |
| InChI | InChI=1S/C18H22FN3O/c1-12-13(2)20-14(3)21-17(12)22-10-8-18(23,9-11-22)15-4-6-16(19)7-5-15/h4-7,23H,8-11H2,1-3H3 |
| InChIKey | AWSNNJNIQDRNQN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | 392 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |