C14H12N2O — CID 56711805
[2-(1H-indazol-5-yl)phenyl]methanol (PubChem CID 56711805) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is [2-(1H-indazol-5-yl)phenyl]methanol.
| Compound Name | [2-(1H-indazol-5-yl)phenyl]methanol |
|---|---|
| PubChem CID | 56711805 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | [2-(1H-indazol-5-yl)phenyl]methanol |
| SMILES | OCc1ccccc1-c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C14H12N2O/c17-9-11-3-1-2-4-13(11)10-5-6-14-12(7-10)8-15-16-14/h1-8,17H,9H2,(H,15,16) |
| InChIKey | YPADFRZBTYKFMF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |