C21H26N4O2 — CID 56712711
3-[4-(5-benzyl-1H-pyrazol-3-yl)piperidine-1-carbonyl]piperidin-2-one (PubChem CID 56712711) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 3-[4-(5-benzyl-1H-pyrazol-3-yl)piperidine-1-carbonyl]piperidin-2-one.
| Compound Name | 3-[4-(5-benzyl-1H-pyrazol-3-yl)piperidine-1-carbonyl]piperidin-2-one |
|---|---|
| PubChem CID | 56712711 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 3-[4-(5-benzyl-1H-pyrazol-3-yl)piperidine-1-carbonyl]piperidin-2-one |
| SMILES | O=C1NCCCC1C(=O)N1CCC(c2cc(Cc3ccccc3)[nH]n2)CC1 |
| InChI | InChI=1S/C21H26N4O2/c26-20-18(7-4-10-22-20)21(27)25-11-8-16(9-12-25)19-14-17(23-24-19)13-15-5-2-1-3-6-15/h1-3,5-6,14,16,18H,4,7-13H2,(H,22,26)(H,23,24) |
| InChIKey | WIYRUHDWTWEHNV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|