C12H21N3 — CID 56714914
N-(1H-imidazol-2-ylmethyl)-N,2,2-trimethylpent-4-en-1-amine (PubChem CID 56714914) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-N,2,2-trimethylpent-4-en-1-amine.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-N,2,2-trimethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 56714914 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-N,2,2-trimethylpent-4-en-1-amine |
| SMILES | C=CCC(C)(C)CN(C)Cc1ncc[nH]1 |
| InChI | InChI=1S/C12H21N3/c1-5-6-12(2,3)10-15(4)9-11-13-7-8-14-11/h5,7-8H,1,6,9-10H2,2-4H3,(H,13,14) |
| InChIKey | LXKQBECHBZFQAF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|