C18H21N5O2S — CID 56716529
5-(3-ethyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbonyl)-6-methyl-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 56716529) has the molecular formula C18H21N5O2S and a molecular weight of 371.47 g/mol. Its IUPAC name is 5-(3-ethyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbonyl)-6-methyl-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 5-(3-ethyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbonyl)-6-methyl-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 56716529 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 5-(3-ethyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbonyl)-6-methyl-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CCc1n[nH]c2c1CN(C(=O)C1=C(C)NC(=O)NC1c1cccs1)CC2 |
| InChI | InChI=1S/C18H21N5O2S/c1-3-12-11-9-23(7-6-13(11)22-21-12)17(24)15-10(2)19-18(25)20-16(15)14-5-4-8-26-14/h4-5,8,16H,3,6-7,9H2,1-2H3,(H,21,22)(H2,19,20,25) |
| InChIKey | VMVOXEAQBQTJEL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |