C16H19N5O2S — CID 95213208
(4R)-N-(3-imidazol-1-ylpropyl)-6-methyl-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 95213208) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is (4R)-N-(3-imidazol-1-ylpropyl)-6-methyl-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4R)-N-(3-imidazol-1-ylpropyl)-6-methyl-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 95213208 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (4R)-N-(3-imidazol-1-ylpropyl)-6-methyl-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)NCCCn2ccnc2)[C@H](c2cccs2)NC(=O)N1 |
| InChI | InChI=1S/C16H19N5O2S/c1-11-13(14(20-16(23)19-11)12-4-2-9-24-12)15(22)18-5-3-7-21-8-6-17-10-21/h2,4,6,8-10,14H,3,5,7H2,1H3,(H,18,22)(H2,19,20,23)/t14-/m0/s1 |
| InChIKey | OTMZDRCMQFOCQT-AWEZNQCLSA-N |
| XLogP | 1.78 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|