C19H29N3O2 — CID 56716835
6-methyl-N-[[1-[(E)-2-methylpent-2-enyl]piperidin-3-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 56716835) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 6-methyl-N-[[1-[(E)-2-methylpent-2-enyl]piperidin-3-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 6-methyl-N-[[1-[(E)-2-methylpent-2-enyl]piperidin-3-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56716835 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 6-methyl-N-[[1-[(E)-2-methylpent-2-enyl]piperidin-3-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CC/C=C(\C)CN1CCCC(CNC(=O)c2ccc(C)[nH]c2=O)C1 |
| InChI | InChI=1S/C19H29N3O2/c1-4-6-14(2)12-22-10-5-7-16(13-22)11-20-18(23)17-9-8-15(3)21-19(17)24/h6,8-9,16H,4-5,7,10-13H2,1-3H3,(H,20,23)(H,21,24)/b14-6+ |
| InChIKey | DYMORIHNSHPGRK-MKMNVTDBSA-N |
| XLogP | 2.48 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|