C15H28N2O — CID 95207973
N-[2-[(3S)-1-[(E)-2-methylpent-2-enyl]piperidin-3-yl]ethyl]acetamide (PubChem CID 95207973) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is N-[2-[(3S)-1-[(E)-2-methylpent-2-enyl]piperidin-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[(3S)-1-[(E)-2-methylpent-2-enyl]piperidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 95207973 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N-[2-[(3S)-1-[(E)-2-methylpent-2-enyl]piperidin-3-yl]ethyl]acetamide |
| SMILES | CC/C=C(\C)CN1CCC[C@@H](CCNC(C)=O)C1 |
| InChI | InChI=1S/C15H28N2O/c1-4-6-13(2)11-17-10-5-7-15(12-17)8-9-16-14(3)18/h6,15H,4-5,7-12H2,1-3H3,(H,16,18)/b13-6+/t15-/m0/s1 |
| InChIKey | RLKJTWOUNDOAFN-NNSJBKGDSA-N |
| XLogP | 2.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|