C19H27N3O2 — CID 56717402
1,3,7-trimethyl-N-[2-(4-methylmorpholin-2-yl)ethyl]indole-2-carboxamide (PubChem CID 56717402) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1,3,7-trimethyl-N-[2-(4-methylmorpholin-2-yl)ethyl]indole-2-carboxamide.
| Compound Name | 1,3,7-trimethyl-N-[2-(4-methylmorpholin-2-yl)ethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 56717402 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1,3,7-trimethyl-N-[2-(4-methylmorpholin-2-yl)ethyl]indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCC2CN(C)CCO2)n(C)c2c(C)cccc12 |
| InChI | InChI=1S/C19H27N3O2/c1-13-6-5-7-16-14(2)18(22(4)17(13)16)19(23)20-9-8-15-12-21(3)10-11-24-15/h5-7,15H,8-12H2,1-4H3,(H,20,23) |
| InChIKey | HARCBPUJFUJFRK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|