C18H24N2O2 — CID 126424749
N,1,3,7-tetramethyl-N-[[(3R)-oxolan-3-yl]methyl]indole-2-carboxamide (PubChem CID 126424749) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N,1,3,7-tetramethyl-N-[[(3R)-oxolan-3-yl]methyl]indole-2-carboxamide.
| Compound Name | N,1,3,7-tetramethyl-N-[[(3R)-oxolan-3-yl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 126424749 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N,1,3,7-tetramethyl-N-[[(3R)-oxolan-3-yl]methyl]indole-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C[C@H]2CCOC2)n(C)c2c(C)cccc12 |
| InChI | InChI=1S/C18H24N2O2/c1-12-6-5-7-15-13(2)17(20(4)16(12)15)18(21)19(3)10-14-8-9-22-11-14/h5-7,14H,8-11H2,1-4H3/t14-/m1/s1 |
| InChIKey | SJOQMZLKBKUFGG-CQSZACIVSA-N |
| XLogP | 2.90 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|