C22H25N3O — CID 99927995
N-[(R)-cyclopropyl(pyridin-2-yl)methyl]-N,1,3,7-tetramethylindole-2-carboxamide (PubChem CID 99927995) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(R)-cyclopropyl(pyridin-2-yl)methyl]-N,1,3,7-tetramethylindole-2-carboxamide.
| Compound Name | N-[(R)-cyclopropyl(pyridin-2-yl)methyl]-N,1,3,7-tetramethylindole-2-carboxamide |
|---|---|
| PubChem CID | 99927995 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[(R)-cyclopropyl(pyridin-2-yl)methyl]-N,1,3,7-tetramethylindole-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)[C@@H](c2ccccn2)C2CC2)n(C)c2c(C)cccc12 |
| InChI | InChI=1S/C22H25N3O/c1-14-8-7-9-17-15(2)20(24(3)19(14)17)22(26)25(4)21(16-11-12-16)18-10-5-6-13-23-18/h5-10,13,16,21H,11-12H2,1-4H3/t21-/m1/s1 |
| InChIKey | MVLBIVJDFRVVSF-OAQYLSRUSA-N |
| XLogP | 4.41 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|