C17H23N3O2 — CID 126426807
N-[(2R)-1-amino-1-oxobutan-2-yl]-N,1,3,7-tetramethylindole-2-carboxamide (PubChem CID 126426807) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(2R)-1-amino-1-oxobutan-2-yl]-N,1,3,7-tetramethylindole-2-carboxamide.
| Compound Name | N-[(2R)-1-amino-1-oxobutan-2-yl]-N,1,3,7-tetramethylindole-2-carboxamide |
|---|---|
| PubChem CID | 126426807 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[(2R)-1-amino-1-oxobutan-2-yl]-N,1,3,7-tetramethylindole-2-carboxamide |
| SMILES | CC[C@H](C(N)=O)N(C)C(=O)c1c(C)c2cccc(C)c2n1C |
| InChI | InChI=1S/C17H23N3O2/c1-6-13(16(18)21)19(4)17(22)15-11(3)12-9-7-8-10(2)14(12)20(15)5/h7-9,13H,6H2,1-5H3,(H2,18,21)/t13-/m1/s1 |
| InChIKey | LBYSHLPYKPTIKD-CYBMUJFWSA-N |
| XLogP | 2.13 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|