C18H23N5O3 — CID 56717493
5-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-1-ethyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid (PubChem CID 56717493) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-1-ethyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
| Compound Name | 5-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-1-ethyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 56717493 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 5-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-1-ethyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| SMILES | CCn1nc(C(=O)O)c2c1CCC(N1Cc3nc(C)n(C)c(=O)c3C1)C2 |
| InChI | InChI=1S/C18H23N5O3/c1-4-23-15-6-5-11(7-12(15)16(20-23)18(25)26)22-8-13-14(9-22)19-10(2)21(3)17(13)24/h11H,4-9H2,1-3H3,(H,25,26) |
| InChIKey | MABRMNUFCFZIQD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |