C15H22N6O2S — CID 56710092
1-ethyl-5-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]-4,5,6,7-tetrahydroindazole-3-carboxylic acid (PubChem CID 56710092) has the molecular formula C15H22N6O2S and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-ethyl-5-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
| Compound Name | 1-ethyl-5-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 56710092 |
| Molecular Formula | C15H22N6O2S |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-ethyl-5-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| SMILES | CCn1nc(C(=O)O)c2c1CCC(NCCSc1n[nH]c(C)n1)C2 |
| InChI | InChI=1S/C15H22N6O2S/c1-3-21-12-5-4-10(8-11(12)13(20-21)14(22)23)16-6-7-24-15-17-9(2)18-19-15/h10,16H,3-8H2,1-2H3,(H,22,23)(H,17,18,19) |
| InChIKey | VJFKLVINJOVHNM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|