C16H28N4O2 — CID 45162613
5-(3-ethoxypropylamino)-1-ethyl-N-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 45162613) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 5-(3-ethoxypropylamino)-1-ethyl-N-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 5-(3-ethoxypropylamino)-1-ethyl-N-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 45162613 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 5-(3-ethoxypropylamino)-1-ethyl-N-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CCOCCCNC1CCc2c(c(C(=O)NC)nn2CC)C1 |
| InChI | InChI=1S/C16H28N4O2/c1-4-20-14-8-7-12(18-9-6-10-22-5-2)11-13(14)15(19-20)16(21)17-3/h12,18H,4-11H2,1-3H3,(H,17,21) |
| InChIKey | STOJHMNYAFDKBK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|