C18H25N5O2 — CID 56721253
1-ethyl-5-[2-[(3-methyl-2-pyridinyl)amino]ethylamino]-4,5,6,7-tetrahydroindazole-3-carboxylic acid (PubChem CID 56721253) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-ethyl-5-[2-[(3-methyl-2-pyridinyl)amino]ethylamino]-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
| Compound Name | 1-ethyl-5-[2-[(3-methyl-2-pyridinyl)amino]ethylamino]-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 56721253 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-ethyl-5-[2-[(3-methyl-2-pyridinyl)amino]ethylamino]-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| SMILES | CCn1nc(C(=O)O)c2c1CCC(NCCNc1ncccc1C)C2 |
| InChI | InChI=1S/C18H25N5O2/c1-3-23-15-7-6-13(11-14(15)16(22-23)18(24)25)19-9-10-21-17-12(2)5-4-8-20-17/h4-5,8,13,19H,3,6-7,9-11H2,1-2H3,(H,20,21)(H,24,25) |
| InChIKey | XDDULFIRPHDLLF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|