C22H34N2OS — CID 56717845
3-[1-[(5-cyclohexylthiophen-2-yl)methyl]piperidin-3-yl]-N-cyclopropylpropanamide (PubChem CID 56717845) has the molecular formula C22H34N2OS and a molecular weight of 374.59 g/mol. Its IUPAC name is 3-[1-[(5-cyclohexylthiophen-2-yl)methyl]piperidin-3-yl]-N-cyclopropylpropanamide.
| Compound Name | 3-[1-[(5-cyclohexylthiophen-2-yl)methyl]piperidin-3-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 56717845 |
| Molecular Formula | C22H34N2OS |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 3-[1-[(5-cyclohexylthiophen-2-yl)methyl]piperidin-3-yl]-N-cyclopropylpropanamide |
| SMILES | O=C(CCC1CCCN(Cc2ccc(C3CCCCC3)s2)C1)NC1CC1 |
| InChI | InChI=1S/C22H34N2OS/c25-22(23-19-9-10-19)13-8-17-5-4-14-24(15-17)16-20-11-12-21(26-20)18-6-2-1-3-7-18/h11-12,17-19H,1-10,13-16H2,(H,23,25) |
| InChIKey | AHXBDWHZYZBKGX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |