C12H14N4O — CID 56720090
6-(6-methoxy-3-pyridinyl)-N,N-dimethylpyrazin-2-amine (PubChem CID 56720090) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 6-(6-methoxy-3-pyridinyl)-N,N-dimethylpyrazin-2-amine.
| Compound Name | 6-(6-methoxy-3-pyridinyl)-N,N-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 56720090 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 6-(6-methoxy-3-pyridinyl)-N,N-dimethylpyrazin-2-amine |
| SMILES | COc1ccc(-c2cncc(N(C)C)n2)cn1 |
| InChI | InChI=1S/C12H14N4O/c1-16(2)11-8-13-7-10(15-11)9-4-5-12(17-3)14-6-9/h4-8H,1-3H3 |
| InChIKey | XPEDPEZBXINPFE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |