About 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one
7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 567228) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one.
Analyze 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one?
The IUPAC name of 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one (CID 567228) is 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one.
What is the SMILES notation for 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one?
The canonical SMILES for 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one is O=C1CCC2(CC1CO)OCCO2.
What is the InChIKey of 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one?
The InChIKey is ZGCCFZTVOBTHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c10-6-7-5-9(2-1-8(7)11)12-3-4-13-9/h7,10H,1-6H2.
What are the key properties of 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one?
7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one has a molecular weight of 186.21 g/mol, XLogP of 0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(hydroxymethyl)-1,4-dioxaspiro[4.5]decan-8-one is sourced from PubChem (CID 567228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).