About methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate
methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate (PubChem CID 56725802) has the molecular formula C13H11F2N3O4
and a molecular weight of 311.24 g/mol. Its IUPAC name is methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate |
| PubChem CID | 56725802 |
| Molecular Formula | C13H11F2N3O4 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate |
| SMILES | COC(=O)C(NC(=O)c1ccccc1)c1nnc(C(F)F)o1 |
| InChI | InChI=1S/C13H11F2N3O4/c1-21-13(20)8(11-17-18-12(22-11)9(14)15)16-10(19)7-5-3-2-4-6-7/h2-6,8-9H,1H3,(H,16,19) |
| InChIKey | JHSNKUHQKHXDHR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate?
The IUPAC name of methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate (CID 56725802) is methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate.
What is the SMILES notation for methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate?
The canonical SMILES for methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate is COC(=O)C(NC(=O)c1ccccc1)c1nnc(C(F)F)o1.
What is the InChIKey of methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate?
The InChIKey is JHSNKUHQKHXDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F2N3O4/c1-21-13(20)8(11-17-18-12(22-11)9(14)15)16-10(19)7-5-3-2-4-6-7/h2-6,8-9H,1H3,(H,16,19).
What are the key properties of methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate?
methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate has a molecular weight of 311.24 g/mol, XLogP of 1.65, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-benzamido-2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetate is sourced from PubChem (CID 56725802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).