C23H20INO3 — CID 56728490
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenylethyl]-2-iodobenzamide (PubChem CID 56728490) has the molecular formula C23H20INO3 and a molecular weight of 485.32 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenylethyl]-2-iodobenzamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenylethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 56728490 |
| Molecular Formula | C23H20INO3 |
| Molecular Weight | 485.32 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-phenylethyl]-2-iodobenzamide |
| SMILES | O=C(NC(Cc1ccccc1)c1ccc2c(c1)OCCO2)c1ccccc1I |
| InChI | InChI=1S/C23H20INO3/c24-19-9-5-4-8-18(19)23(26)25-20(14-16-6-2-1-3-7-16)17-10-11-21-22(15-17)28-13-12-27-21/h1-11,15,20H,12-14H2,(H,25,26) |
| InChIKey | KVQGDSVXNGEOMS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|