C11H11FN2O2 — CID 56731477
1-[(2-fluorophenyl)methyl]piperazine-2,3-dione (PubChem CID 56731477) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]piperazine-2,3-dione.
| Compound Name | 1-[(2-fluorophenyl)methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 56731477 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]piperazine-2,3-dione |
| SMILES | O=C1NCCN(Cc2ccccc2F)C1=O |
| InChI | InChI=1S/C11H11FN2O2/c12-9-4-2-1-3-8(9)7-14-6-5-13-10(15)11(14)16/h1-4H,5-7H2,(H,13,15) |
| InChIKey | LJFIJZQGAVDVHQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|