About 4-bromo-3-(1,2,4-triazol-4-yl)benzamide
4-bromo-3-(1,2,4-triazol-4-yl)benzamide (PubChem CID 56737242) has the molecular formula C9H7BrN4O
and a molecular weight of 267.09 g/mol. Its IUPAC name is 4-bromo-3-(1,2,4-triazol-4-yl)benzamide.
Molecular Properties
| Compound Name | 4-bromo-3-(1,2,4-triazol-4-yl)benzamide |
| PubChem CID | 56737242 |
| Molecular Formula | C9H7BrN4O |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 4-bromo-3-(1,2,4-triazol-4-yl)benzamide |
| SMILES | NC(=O)c1ccc(Br)c(-n2cnnc2)c1 |
| InChI | InChI=1S/C9H7BrN4O/c10-7-2-1-6(9(11)15)3-8(7)14-4-12-13-5-14/h1-5H,(H2,11,15) |
| InChIKey | VZQWYDBSODCSFR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-3-(1,2,4-triazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-(1,2,4-triazol-4-yl)benzamide?
The IUPAC name of 4-bromo-3-(1,2,4-triazol-4-yl)benzamide (CID 56737242) is 4-bromo-3-(1,2,4-triazol-4-yl)benzamide.
What is the SMILES notation for 4-bromo-3-(1,2,4-triazol-4-yl)benzamide?
The canonical SMILES for 4-bromo-3-(1,2,4-triazol-4-yl)benzamide is NC(=O)c1ccc(Br)c(-n2cnnc2)c1.
What is the InChIKey of 4-bromo-3-(1,2,4-triazol-4-yl)benzamide?
The InChIKey is VZQWYDBSODCSFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN4O/c10-7-2-1-6(9(11)15)3-8(7)14-4-12-13-5-14/h1-5H,(H2,11,15).
What are the key properties of 4-bromo-3-(1,2,4-triazol-4-yl)benzamide?
4-bromo-3-(1,2,4-triazol-4-yl)benzamide has a molecular weight of 267.09 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-(1,2,4-triazol-4-yl)benzamide is sourced from PubChem (CID 56737242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).