C11H9Cl2N3O2 — CID 56737256
ethyl 2,4-dichloro-5-(1,2,4-triazol-4-yl)benzoate (PubChem CID 56737256) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is ethyl 2,4-dichloro-5-(1,2,4-triazol-4-yl)benzoate.
| Compound Name | ethyl 2,4-dichloro-5-(1,2,4-triazol-4-yl)benzoate |
|---|---|
| PubChem CID | 56737256 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | ethyl 2,4-dichloro-5-(1,2,4-triazol-4-yl)benzoate |
| SMILES | CCOC(=O)c1cc(-n2cnnc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2N3O2/c1-2-18-11(17)7-3-10(9(13)4-8(7)12)16-5-14-15-6-16/h3-6H,2H2,1H3 |
| InChIKey | QHNOUUOPOXGQPO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |