C15H15ClFN3O4 — CID 13372501
ethyl 2-chloro-5-(1,3-dioxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)-4-fluorobenzoate (PubChem CID 13372501) has the molecular formula C15H15ClFN3O4 and a molecular weight of 355.75 g/mol. Its IUPAC name is ethyl 2-chloro-5-(1,3-dioxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)-4-fluorobenzoate.
| Compound Name | ethyl 2-chloro-5-(1,3-dioxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 13372501 |
| Molecular Formula | C15H15ClFN3O4 |
| Molecular Weight | 355.75 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | ethyl 2-chloro-5-(1,3-dioxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)-4-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(-n2c(=O)n3n(c2=O)CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C15H15ClFN3O4/c1-2-24-13(21)9-7-12(11(17)8-10(9)16)20-14(22)18-5-3-4-6-19(18)15(20)23/h7-8H,2-6H2,1H3 |
| InChIKey | INMIUVCPSFHEGK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.75 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |